C14H11N3O2S — CID 103119517
1-(1-methylindazol-3-yl)-3-(1,3-thiazol-4-yl)propane-1,3-dione (PubChem CID 103119517) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(1-methylindazol-3-yl)-3-(1,3-thiazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(1-methylindazol-3-yl)-3-(1,3-thiazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 103119517 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(1-methylindazol-3-yl)-3-(1,3-thiazol-4-yl)propane-1,3-dione |
| SMILES | Cn1nc(C(=O)CC(=O)c2cscn2)c2ccccc21 |
| InChI | InChI=1S/C14H11N3O2S/c1-17-11-5-3-2-4-9(11)14(16-17)13(19)6-12(18)10-7-20-8-15-10/h2-5,7-8H,6H2,1H3 |
| InChIKey | UGCDSOGBULICDH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|