C11H15N3O3S — CID 146084367
5-(methoxymethyl)-5-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 146084367) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-(methoxymethyl)-5-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(methoxymethyl)-5-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146084367 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-(methoxymethyl)-5-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COCC1(C)NC(=O)N(Cc2csc(C)n2)C1=O |
| InChI | InChI=1S/C11H15N3O3S/c1-7-12-8(5-18-7)4-14-9(15)11(2,6-17-3)13-10(14)16/h5H,4,6H2,1-3H3,(H,13,16) |
| InChIKey | QZDGEWWNPBWPED-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|