C11H14ClN3O2S — CID 43320529
3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 43320529) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43320529 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1(C)NC(=O)N(Cc2nc(CCl)cs2)C1=O |
| InChI | InChI=1S/C11H14ClN3O2S/c1-3-11(2)9(16)15(10(17)14-11)5-8-13-7(4-12)6-18-8/h6H,3-5H2,1-2H3,(H,14,17) |
| InChIKey | BGRVLPLVVDIMOJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|