C13H15N5O2S — CID 62209030
3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 62209030) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62209030 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1(C)NC(=O)N(Cc2nc(N)c3ccsc3n2)C1=O |
| InChI | InChI=1S/C13H15N5O2S/c1-3-13(2)11(19)18(12(20)17-13)6-8-15-9(14)7-4-5-21-10(7)16-8/h4-5H,3,6H2,1-2H3,(H,17,20)(H2,14,15,16) |
| InChIKey | YFGGGWUYEBWGDO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|