About 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one
1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one (PubChem CID 80583067) has the molecular formula C13H15N5OS
and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one.
Molecular Properties
| Compound Name | 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one |
| PubChem CID | 80583067 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one |
| SMILES | CC(C)n1ccn(Cc2nc(N)c3ccsc3n2)c1=O |
| InChI | InChI=1S/C13H15N5OS/c1-8(2)18-5-4-17(13(18)19)7-10-15-11(14)9-3-6-20-12(9)16-10/h3-6,8H,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | NFCSQKHPAXSBEU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one?
The IUPAC name of 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one (CID 80583067) is 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one.
What is the SMILES notation for 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one?
The canonical SMILES for 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one is CC(C)n1ccn(Cc2nc(N)c3ccsc3n2)c1=O.
What is the InChIKey of 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one?
The InChIKey is NFCSQKHPAXSBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5OS/c1-8(2)18-5-4-17(13(18)19)7-10-15-11(14)9-3-6-20-12(9)16-10/h3-6,8H,7H2,1-2H3,(H2,14,15,16).
What are the key properties of 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one?
1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one has a molecular weight of 289.36 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl]-3-propan-2-ylimidazol-2-one is sourced from PubChem (CID 80583067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).