C9H10N2O2S — CID 103621020
3-[(5-methylthiophen-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 103621020) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-[(5-methylthiophen-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(5-methylthiophen-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103621020 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-[(5-methylthiophen-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)CNC2=O)s1 |
| InChI | InChI=1S/C9H10N2O2S/c1-6-2-3-7(14-6)5-11-8(12)4-10-9(11)13/h2-3H,4-5H2,1H3,(H,10,13) |
| InChIKey | MLTJBSGJRDEVQG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|