C9H11N3O3 — CID 82507746
3-[[2-(aminomethyl)furan-3-yl]methyl]imidazolidine-2,4-dione (PubChem CID 82507746) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)furan-3-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[2-(aminomethyl)furan-3-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82507746 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-[[2-(aminomethyl)furan-3-yl]methyl]imidazolidine-2,4-dione |
| SMILES | NCc1occc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H11N3O3/c10-3-7-6(1-2-15-7)5-12-8(13)4-11-9(12)14/h1-2H,3-5,10H2,(H,11,14) |
| InChIKey | QAUVIDCRGPBYRB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|