C10H12N2O2S — CID 63788380
4-[(5-methylthiophen-2-yl)methyl]piperazine-2,6-dione (PubChem CID 63788380) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-[(5-methylthiophen-2-yl)methyl]piperazine-2,6-dione.
| Compound Name | 4-[(5-methylthiophen-2-yl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 63788380 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-[(5-methylthiophen-2-yl)methyl]piperazine-2,6-dione |
| SMILES | Cc1ccc(CN2CC(=O)NC(=O)C2)s1 |
| InChI | InChI=1S/C10H12N2O2S/c1-7-2-3-8(15-7)4-12-5-9(13)11-10(14)6-12/h2-3H,4-6H2,1H3,(H,11,13,14) |
| InChIKey | CVKVGZXHJAGYBE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|