C18H25N5OS — CID 56913541
4-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]piperazin-2-one (PubChem CID 56913541) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 56913541 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]piperazin-2-one |
| SMILES | Cc1ccc(CN2CCCn3nc(CN4CCNC(=O)C4)cc3C2)s1 |
| InChI | InChI=1S/C18H25N5OS/c1-14-3-4-17(25-14)12-21-6-2-7-23-16(11-21)9-15(20-23)10-22-8-5-19-18(24)13-22/h3-4,9H,2,5-8,10-13H2,1H3,(H,19,24) |
| InChIKey | QDEUCIMVXCOXDJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |