C20H27N5O — CID 56910304
1-(3,5-dimethylphenyl)-4-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)piperazin-2-one (PubChem CID 56910304) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)piperazin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-4-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 56910304 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)piperazin-2-one |
| SMILES | Cc1cc(C)cc(N2CCN(Cc3cc4n(n3)CCCNC4)CC2=O)c1 |
| InChI | InChI=1S/C20H27N5O/c1-15-8-16(2)10-18(9-15)24-7-6-23(14-20(24)26)13-17-11-19-12-21-4-3-5-25(19)22-17/h8-11,21H,3-7,12-14H2,1-2H3 |
| InChIKey | QYPWJJIVBKSMID-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |