C21H31N5 — CID 144720933
5-[(3,5-dimethylphenyl)methyl]-2-(piperazin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 144720933) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenyl)methyl]-2-(piperazin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | 5-[(3,5-dimethylphenyl)methyl]-2-(piperazin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 144720933 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 5-[(3,5-dimethylphenyl)methyl]-2-(piperazin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | Cc1cc(C)cc(CN2CCCn3nc(CN4CCNCC4)cc3C2)c1 |
| InChI | InChI=1S/C21H31N5/c1-17-10-18(2)12-19(11-17)14-25-6-3-7-26-21(16-25)13-20(23-26)15-24-8-4-22-5-9-24/h10-13,22H,3-9,14-16H2,1-2H3 |
| InChIKey | RCKLJWBCMUFOGK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |