C10H14N4 — CID 84771588
1-(2-aminoethyl)-5-methylbenzimidazol-2-amine (PubChem CID 84771588) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(2-aminoethyl)-5-methylbenzimidazol-2-amine.
| Compound Name | 1-(2-aminoethyl)-5-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 84771588 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(2-aminoethyl)-5-methylbenzimidazol-2-amine |
| SMILES | Cc1ccc2c(c1)nc(N)n2CCN |
| InChI | InChI=1S/C10H14N4/c1-7-2-3-9-8(6-7)13-10(12)14(9)5-4-11/h2-3,6H,4-5,11H2,1H3,(H2,12,13) |
| InChIKey | RDYAXRNCVNBKRQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |