C13H15N5 — CID 54951144
5-methyl-1-(2-pyrazol-1-ylethyl)benzimidazol-2-amine (PubChem CID 54951144) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 5-methyl-1-(2-pyrazol-1-ylethyl)benzimidazol-2-amine.
| Compound Name | 5-methyl-1-(2-pyrazol-1-ylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 54951144 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-methyl-1-(2-pyrazol-1-ylethyl)benzimidazol-2-amine |
| SMILES | Cc1ccc2c(c1)nc(N)n2CCn1cccn1 |
| InChI | InChI=1S/C13H15N5/c1-10-3-4-12-11(9-10)16-13(14)18(12)8-7-17-6-2-5-15-17/h2-6,9H,7-8H2,1H3,(H2,14,16) |
| InChIKey | GFONAFJNGJCEPZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |