C18H21N7 — CID 135409793
4-(5-butyl-1H-[1,2,4]triazolo[5,1-f]purin-8-yl)-N,N-dimethylaniline (PubChem CID 135409793) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-(5-butyl-1H-[1,2,4]triazolo[5,1-f]purin-8-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5-butyl-1H-[1,2,4]triazolo[5,1-f]purin-8-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 135409793 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-(5-butyl-1H-[1,2,4]triazolo[5,1-f]purin-8-yl)-N,N-dimethylaniline |
| SMILES | CCCCc1nc2nc[nH]c2c2nc(-c3ccc(N(C)C)cc3)nn12 |
| InChI | InChI=1S/C18H21N7/c1-4-5-6-14-21-17-15(19-11-20-17)18-22-16(23-25(14)18)12-7-9-13(10-8-12)24(2)3/h7-11H,4-6H2,1-3H3,(H,19,20) |
| InChIKey | KYKFWXJBEABAMM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |