C13H11F3N4S — CID 63239906
1-[2-(1,3-thiazol-2-yl)ethyl]-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 63239906) has the molecular formula C13H11F3N4S and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-[2-(1,3-thiazol-2-yl)ethyl]-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-[2-(1,3-thiazol-2-yl)ethyl]-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 63239906 |
| Molecular Formula | C13H11F3N4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1-[2-(1,3-thiazol-2-yl)ethyl]-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C(F)(F)F)n2CCc1nccs1 |
| InChI | InChI=1S/C13H11F3N4S/c14-13(15,16)12-19-9-7-8(17)1-2-10(9)20(12)5-3-11-18-4-6-21-11/h1-2,4,6-7H,3,5,17H2 |
| InChIKey | MCJXNRZCPCTKIO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|