C13H14F3N3S — CID 107298298
1-(thiolan-3-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 107298298) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-(thiolan-3-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-(thiolan-3-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 107298298 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(thiolan-3-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C(F)(F)F)n2CC1CCSC1 |
| InChI | InChI=1S/C13H14F3N3S/c14-13(15,16)12-18-10-5-9(17)1-2-11(10)19(12)6-8-3-4-20-7-8/h1-2,5,8H,3-4,6-7,17H2 |
| InChIKey | KQIOMFYHWQURLL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|