C12H9F3N4S — CID 63824827
1-(1,3-thiazol-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 63824827) has the molecular formula C12H9F3N4S and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-(1,3-thiazol-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-(1,3-thiazol-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 63824827 |
| Molecular Formula | C12H9F3N4S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-(1,3-thiazol-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C(F)(F)F)n2Cc1cscn1 |
| InChI | InChI=1S/C12H9F3N4S/c13-12(14,15)11-18-9-3-7(16)1-2-10(9)19(11)4-8-5-20-6-17-8/h1-3,5-6H,4,16H2 |
| InChIKey | PHHMFQAFATYFLB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|