C11H11F4N3 — CID 114267054
1-(3-fluoropropyl)-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 114267054) has the molecular formula C11H11F4N3 and a molecular weight of 261.22 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-(3-fluoropropyl)-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 114267054 |
| Molecular Formula | C11H11F4N3 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-(3-fluoropropyl)-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C(F)(F)F)n2CCCF |
| InChI | InChI=1S/C11H11F4N3/c12-4-1-5-18-9-3-2-7(16)6-8(9)17-10(18)11(13,14)15/h2-3,6H,1,4-5,16H2 |
| InChIKey | SUJKXEXRZSGFNJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|