C12H14F3N3O — CID 64912559
4-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]butan-2-ol (PubChem CID 64912559) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 4-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]butan-2-ol.
| Compound Name | 4-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 64912559 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]butan-2-ol |
| SMILES | CC(O)CCn1c(C(F)(F)F)nc2cc(N)ccc21 |
| InChI | InChI=1S/C12H14F3N3O/c1-7(19)4-5-18-10-3-2-8(16)6-9(10)17-11(18)12(13,14)15/h2-3,6-7,19H,4-5,16H2,1H3 |
| InChIKey | YSHLBOUCWFBBPL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|