C13H15F3N4O — CID 106098518
3-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]-3-methylbutanamide (PubChem CID 106098518) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 3-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]-3-methylbutanamide.
| Compound Name | 3-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106098518 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-[5-amino-2-(trifluoromethyl)benzimidazol-1-yl]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)n1c(C(F)(F)F)nc2cc(N)ccc21 |
| InChI | InChI=1S/C13H15F3N4O/c1-12(2,6-10(18)21)20-9-4-3-7(17)5-8(9)19-11(20)13(14,15)16/h3-5H,6,17H2,1-2H3,(H2,18,21) |
| InChIKey | GDXMLJACFRYCRL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|