C13H14Cl3N3O — CID 106097692
3-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide (PubChem CID 106097692) has the molecular formula C13H14Cl3N3O and a molecular weight of 334.63 g/mol. Its IUPAC name is 3-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide.
| Compound Name | 3-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097692 |
| Molecular Formula | C13H14Cl3N3O |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)n1c(CCl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C13H14Cl3N3O/c1-13(2,5-11(17)20)19-10-4-8(16)7(15)3-9(10)18-12(19)6-14/h3-4H,5-6H2,1-2H3,(H2,17,20) |
| InChIKey | WGMIMVIWAVAXFY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|