C13H15Cl2N3O — CID 106097695
3-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide (PubChem CID 106097695) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 3-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide.
| Compound Name | 3-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097695 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)n1c(CCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C13H15Cl2N3O/c1-13(2,6-10(16)19)18-9-5-3-4-8(15)12(9)17-11(18)7-14/h3-5H,6-7H2,1-2H3,(H2,16,19) |
| InChIKey | QSMQSEHPIONRFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|