C14H18F3N3 — CID 106329553
1-(3-methylpentan-3-yl)-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 106329553) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-(3-methylpentan-3-yl)-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-(3-methylpentan-3-yl)-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 106329553 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(3-methylpentan-3-yl)-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | CCC(C)(CC)n1c(C(F)(F)F)nc2cc(N)ccc21 |
| InChI | InChI=1S/C14H18F3N3/c1-4-13(3,5-2)20-11-7-6-9(18)8-10(11)19-12(20)14(15,16)17/h6-8H,4-5,18H2,1-3H3 |
| InChIKey | QHSXRGIQRCPVRQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|