C11H9F6N3S — CID 106432377
2-(trifluoromethyl)-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-5-amine (PubChem CID 106432377) has the molecular formula C11H9F6N3S and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-5-amine.
| Compound Name | 2-(trifluoromethyl)-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 106432377 |
| Molecular Formula | C11H9F6N3S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(trifluoromethyl)-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C(F)(F)F)n2CCSC(F)(F)F |
| InChI | InChI=1S/C11H9F6N3S/c12-10(13,14)9-19-7-5-6(18)1-2-8(7)20(9)3-4-21-11(15,16)17/h1-2,5H,3-4,18H2 |
| InChIKey | DNXMZEVNDZGUFV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|