C16H24N4O — CID 62493100
2-(5-amino-2-tert-butylbenzimidazol-1-yl)-N,N-dimethylpropanamide (PubChem CID 62493100) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-(5-amino-2-tert-butylbenzimidazol-1-yl)-N,N-dimethylpropanamide.
| Compound Name | 2-(5-amino-2-tert-butylbenzimidazol-1-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 62493100 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-(5-amino-2-tert-butylbenzimidazol-1-yl)-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(C(C)(C)C)nc2cc(N)ccc21 |
| InChI | InChI=1S/C16H24N4O/c1-10(14(21)19(5)6)20-13-8-7-11(17)9-12(13)18-15(20)16(2,3)4/h7-10H,17H2,1-6H3 |
| InChIKey | CLBHWIUJDWQPHR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|