C12H13BrClFN2S — CID 116739118
6-bromo-2-(chloromethyl)-5-fluoro-1-(3-methylsulfanylpropyl)benzimidazole (PubChem CID 116739118) has the molecular formula C12H13BrClFN2S and a molecular weight of 351.67 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-5-fluoro-1-(3-methylsulfanylpropyl)benzimidazole.
| Compound Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(3-methylsulfanylpropyl)benzimidazole |
|---|---|
| PubChem CID | 116739118 |
| Molecular Formula | C12H13BrClFN2S |
| Molecular Weight | 351.67 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(3-methylsulfanylpropyl)benzimidazole |
| SMILES | CSCCCn1c(CCl)nc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C12H13BrClFN2S/c1-18-4-2-3-17-11-5-8(13)9(15)6-10(11)16-12(17)7-14/h5-6H,2-4,7H2,1H3 |
| InChIKey | TZYWFJXWLQEXAI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|