C12H16BrN3O — CID 82332822
[5-bromo-1-[2-(dimethylamino)ethyl]benzimidazol-2-yl]methanol (PubChem CID 82332822) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is [5-bromo-1-[2-(dimethylamino)ethyl]benzimidazol-2-yl]methanol.
| Compound Name | [5-bromo-1-[2-(dimethylamino)ethyl]benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 82332822 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [5-bromo-1-[2-(dimethylamino)ethyl]benzimidazol-2-yl]methanol |
| SMILES | CN(C)CCn1c(CO)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H16BrN3O/c1-15(2)5-6-16-11-4-3-9(13)7-10(11)14-12(16)8-17/h3-4,7,17H,5-6,8H2,1-2H3 |
| InChIKey | PYCDQZRFUKHBIQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |