C12H12F3N3O2S — CID 83018564
2-[1-(dimethylamino)-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 83018564) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[1-(dimethylamino)-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(dimethylamino)-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 83018564 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[1-(dimethylamino)-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CN(C)n1c(SCC(=O)O)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H12F3N3O2S/c1-17(2)18-9-4-3-7(12(13,14)15)5-8(9)16-11(18)21-6-10(19)20/h3-5H,6H2,1-2H3,(H,19,20) |
| InChIKey | PHAZVAJQWXUSAZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |