C10H9FN2O2S — CID 43661245
2-(5-fluoro-1-methylbenzimidazol-2-yl)sulfanylacetic acid (PubChem CID 43661245) has the molecular formula C10H9FN2O2S and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(5-fluoro-1-methylbenzimidazol-2-yl)sulfanylacetic acid.
| Compound Name | 2-(5-fluoro-1-methylbenzimidazol-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 43661245 |
| Molecular Formula | C10H9FN2O2S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(5-fluoro-1-methylbenzimidazol-2-yl)sulfanylacetic acid |
| SMILES | Cn1c(SCC(=O)O)nc2cc(F)ccc21 |
| InChI | InChI=1S/C10H9FN2O2S/c1-13-8-3-2-6(11)4-7(8)12-10(13)16-5-9(14)15/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | MTIPSRKWZAXIBV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |