C13H14FN3O3S — CID 62376716
2-[1-(2-acetamidoethyl)-6-fluorobenzimidazol-2-yl]sulfanylacetic acid (PubChem CID 62376716) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[1-(2-acetamidoethyl)-6-fluorobenzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(2-acetamidoethyl)-6-fluorobenzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62376716 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[1-(2-acetamidoethyl)-6-fluorobenzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CC(=O)NCCn1c(SCC(=O)O)nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FN3O3S/c1-8(18)15-4-5-17-11-6-9(14)2-3-10(11)16-13(17)21-7-12(19)20/h2-3,6H,4-5,7H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | USENEMBIIVXGKA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |