C15H21Cl2N3O — CID 106005185
6-chloro-2-(1-chloroethyl)-3-(4-propan-2-yloxybutyl)imidazo[4,5-b]pyridine (PubChem CID 106005185) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is 6-chloro-2-(1-chloroethyl)-3-(4-propan-2-yloxybutyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-chloro-2-(1-chloroethyl)-3-(4-propan-2-yloxybutyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 106005185 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-chloro-2-(1-chloroethyl)-3-(4-propan-2-yloxybutyl)imidazo[4,5-b]pyridine |
| SMILES | CC(C)OCCCCn1c(C(C)Cl)nc2cc(Cl)cnc21 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-10(2)21-7-5-4-6-20-14(11(3)16)19-13-8-12(17)9-18-15(13)20/h8-11H,4-7H2,1-3H3 |
| InChIKey | KEFNMTGZDUSFCG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|