C15H19BrClN3O — CID 79279906
6-bromo-2-(1-chloroethyl)-3-(2-cyclopentyloxyethyl)imidazo[4,5-b]pyridine (PubChem CID 79279906) has the molecular formula C15H19BrClN3O and a molecular weight of 372.69 g/mol. Its IUPAC name is 6-bromo-2-(1-chloroethyl)-3-(2-cyclopentyloxyethyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(1-chloroethyl)-3-(2-cyclopentyloxyethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79279906 |
| Molecular Formula | C15H19BrClN3O |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 6-bromo-2-(1-chloroethyl)-3-(2-cyclopentyloxyethyl)imidazo[4,5-b]pyridine |
| SMILES | CC(Cl)c1nc2cc(Br)cnc2n1CCOC1CCCC1 |
| InChI | InChI=1S/C15H19BrClN3O/c1-10(17)14-19-13-8-11(16)9-18-15(13)20(14)6-7-21-12-4-2-3-5-12/h8-10,12H,2-7H2,1H3 |
| InChIKey | XIEAXGCZMJKKME-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|