C16H20Cl2N2O — CID 63827040
5-chloro-2-(1-chloroethyl)-1-(2-cyclopentyloxyethyl)benzimidazole (PubChem CID 63827040) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is 5-chloro-2-(1-chloroethyl)-1-(2-cyclopentyloxyethyl)benzimidazole.
| Compound Name | 5-chloro-2-(1-chloroethyl)-1-(2-cyclopentyloxyethyl)benzimidazole |
|---|---|
| PubChem CID | 63827040 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5-chloro-2-(1-chloroethyl)-1-(2-cyclopentyloxyethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Cl)ccc2n1CCOC1CCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-11(17)16-19-14-10-12(18)6-7-15(14)20(16)8-9-21-13-4-2-3-5-13/h6-7,10-11,13H,2-5,8-9H2,1H3 |
| InChIKey | GUJCLXYTIJJCLW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|