C12H16ClN3O2 — CID 141490565
6-chloro-2-(diethoxymethyl)-3-methylimidazo[4,5-b]pyridine (PubChem CID 141490565) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 6-chloro-2-(diethoxymethyl)-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 6-chloro-2-(diethoxymethyl)-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 141490565 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 6-chloro-2-(diethoxymethyl)-3-methylimidazo[4,5-b]pyridine |
| SMILES | CCOC(OCC)c1nc2cc(Cl)cnc2n1C |
| InChI | InChI=1S/C12H16ClN3O2/c1-4-17-12(18-5-2)11-15-9-6-8(13)7-14-10(9)16(11)3/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | VJOGHKROXZEUPD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|