C13H17Cl2N5 — CID 83017147
6-chloro-2-(1-chloroethyl)-3-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine (PubChem CID 83017147) has the molecular formula C13H17Cl2N5 and a molecular weight of 314.22 g/mol. Its IUPAC name is 6-chloro-2-(1-chloroethyl)-3-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine.
| Compound Name | 6-chloro-2-(1-chloroethyl)-3-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 83017147 |
| Molecular Formula | C13H17Cl2N5 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 6-chloro-2-(1-chloroethyl)-3-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine |
| SMILES | CC(Cl)c1nc2cc(Cl)cnc2n1N1CCN(C)CC1 |
| InChI | InChI=1S/C13H17Cl2N5/c1-9(14)12-17-11-7-10(15)8-16-13(11)20(12)19-5-3-18(2)4-6-19/h7-9H,3-6H2,1-2H3 |
| InChIKey | JTJJNHVXDPEXRZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|