C13H13Cl2N5O — CID 106420154
3-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 106420154) has the molecular formula C13H13Cl2N5O and a molecular weight of 326.19 g/mol. Its IUPAC name is 3-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106420154 |
| Molecular Formula | C13H13Cl2N5O |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(CCn2c(C(C)Cl)nc3cc(Cl)cnc32)no1 |
| InChI | InChI=1S/C13H13Cl2N5O/c1-7(14)12-18-10-5-9(15)6-16-13(10)20(12)4-3-11-17-8(2)21-19-11/h5-7H,3-4H2,1-2H3 |
| InChIKey | TWFYNNKURDBAOY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|