C14H14ClIN4O — CID 106420145
3-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 106420145) has the molecular formula C14H14ClIN4O and a molecular weight of 416.65 g/mol. Its IUPAC name is 3-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106420145 |
| Molecular Formula | C14H14ClIN4O |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 3-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(CCn2c(C(C)Cl)nc3cc(I)ccc32)no1 |
| InChI | InChI=1S/C14H14ClIN4O/c1-8(15)14-18-11-7-10(16)3-4-12(11)20(14)6-5-13-17-9(2)21-19-13/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | JCVFBZKMGOALHL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|