About 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine
5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine (PubChem CID 106419713) has the molecular formula C12H12IN5O
and a molecular weight of 369.17 g/mol. Its IUPAC name is 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine.
Molecular Properties
| Compound Name | 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
| PubChem CID | 106419713 |
| Molecular Formula | C12H12IN5O |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cc1nc(CCn2c(N)nc3cc(I)ccc32)no1 |
| InChI | InChI=1S/C12H12IN5O/c1-7-15-11(17-19-7)4-5-18-10-3-2-8(13)6-9(10)16-12(18)14/h2-3,6H,4-5H2,1H3,(H2,14,16) |
| InChIKey | FUZFLHJKSOIIGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine?
The IUPAC name of 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine (CID 106419713) is 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine.
What is the SMILES notation for 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine?
The canonical SMILES for 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine is Cc1nc(CCn2c(N)nc3cc(I)ccc32)no1.
What is the InChIKey of 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine?
The InChIKey is FUZFLHJKSOIIGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12IN5O/c1-7-15-11(17-19-7)4-5-18-10-3-2-8(13)6-9(10)16-12(18)14/h2-3,6H,4-5H2,1H3,(H2,14,16).
What are the key properties of 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine?
5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine has a molecular weight of 369.17 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine is sourced from PubChem (CID 106419713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).