C12H12IN5O — CID 106419713
5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine (PubChem CID 106419713) has the molecular formula C12H12IN5O and a molecular weight of 369.17 g/mol. Its IUPAC name is 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 106419713 |
| Molecular Formula | C12H12IN5O |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 5-iodo-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cc1nc(CCn2c(N)nc3cc(I)ccc32)no1 |
| InChI | InChI=1S/C12H12IN5O/c1-7-15-11(17-19-7)4-5-18-10-3-2-8(13)6-9(10)16-12(18)14/h2-3,6H,4-5H2,1H3,(H2,14,16) |
| InChIKey | FUZFLHJKSOIIGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|