C15H23IN4 — CID 66080783
1-[2-[di(propan-2-yl)amino]ethyl]-5-iodobenzimidazol-2-amine (PubChem CID 66080783) has the molecular formula C15H23IN4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-5-iodobenzimidazol-2-amine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66080783 |
| Molecular Formula | C15H23IN4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-5-iodobenzimidazol-2-amine |
| SMILES | CC(C)N(CCn1c(N)nc2cc(I)ccc21)C(C)C |
| InChI | InChI=1S/C15H23IN4/c1-10(2)19(11(3)4)7-8-20-14-6-5-12(16)9-13(14)18-15(20)17/h5-6,9-11H,7-8H2,1-4H3,(H2,17,18) |
| InChIKey | NMIRHGODXKNPLB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|