C12H16IN3S — CID 66080022
5-iodo-1-(2-methyl-3-methylsulfanylpropyl)benzimidazol-2-amine (PubChem CID 66080022) has the molecular formula C12H16IN3S and a molecular weight of 361.25 g/mol. Its IUPAC name is 5-iodo-1-(2-methyl-3-methylsulfanylpropyl)benzimidazol-2-amine.
| Compound Name | 5-iodo-1-(2-methyl-3-methylsulfanylpropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66080022 |
| Molecular Formula | C12H16IN3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 5-iodo-1-(2-methyl-3-methylsulfanylpropyl)benzimidazol-2-amine |
| SMILES | CSCC(C)Cn1c(N)nc2cc(I)ccc21 |
| InChI | InChI=1S/C12H16IN3S/c1-8(7-17-2)6-16-11-4-3-9(13)5-10(11)15-12(16)14/h3-5,8H,6-7H2,1-2H3,(H2,14,15) |
| InChIKey | CXVVIEWWIQNMAB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|