C14H16IN5 — CID 115990863
1-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-iodobenzimidazol-2-amine (PubChem CID 115990863) has the molecular formula C14H16IN5 and a molecular weight of 381.22 g/mol. Its IUPAC name is 1-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-iodobenzimidazol-2-amine.
| Compound Name | 1-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 115990863 |
| Molecular Formula | C14H16IN5 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-iodobenzimidazol-2-amine |
| SMILES | CCc1nn(C)cc1Cn1c(N)nc2cc(I)ccc21 |
| InChI | InChI=1S/C14H16IN5/c1-3-11-9(7-19(2)18-11)8-20-13-5-4-10(15)6-12(13)17-14(20)16/h4-7H,3,8H2,1-2H3,(H2,16,17) |
| InChIKey | NVFMRHVXBTZSIF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|