C15H17ClN4S — CID 106037177
4-[2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethyl]-2-methyl-1,3-thiazole (PubChem CID 106037177) has the molecular formula C15H17ClN4S and a molecular weight of 320.85 g/mol. Its IUPAC name is 4-[2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 106037177 |
| Molecular Formula | C15H17ClN4S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1cnc2c(c1)nc(C(C)Cl)n2CCc1csc(C)n1 |
| InChI | InChI=1S/C15H17ClN4S/c1-9-6-13-15(17-7-9)20(14(19-13)10(2)16)5-4-12-8-21-11(3)18-12/h6-8,10H,4-5H2,1-3H3 |
| InChIKey | QLBFOTPUVOSDNR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|