C14H13Cl2N3S — CID 104837876
4-[[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 104837876) has the molecular formula C14H13Cl2N3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 4-[[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 104837876 |
| Molecular Formula | C14H13Cl2N3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 4-[[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(Cn2c(C(C)Cl)nc3c(Cl)cccc32)cs1 |
| InChI | InChI=1S/C14H13Cl2N3S/c1-8(15)14-18-13-11(16)4-3-5-12(13)19(14)6-10-7-20-9(2)17-10/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | ZXYSHGXGXZYNCC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|