C16H21Cl2N3 — CID 104838530
4-chloro-2-(1-chloroethyl)-1-(2-pyrrolidin-1-ylpropyl)benzimidazole (PubChem CID 104838530) has the molecular formula C16H21Cl2N3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 4-chloro-2-(1-chloroethyl)-1-(2-pyrrolidin-1-ylpropyl)benzimidazole.
| Compound Name | 4-chloro-2-(1-chloroethyl)-1-(2-pyrrolidin-1-ylpropyl)benzimidazole |
|---|---|
| PubChem CID | 104838530 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-chloro-2-(1-chloroethyl)-1-(2-pyrrolidin-1-ylpropyl)benzimidazole |
| SMILES | CC(Cl)c1nc2c(Cl)cccc2n1CC(C)N1CCCC1 |
| InChI | InChI=1S/C16H21Cl2N3/c1-11(20-8-3-4-9-20)10-21-14-7-5-6-13(18)15(14)19-16(21)12(2)17/h5-7,11-12H,3-4,8-10H2,1-2H3 |
| InChIKey | PYVDCLUUCDANHO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|