C13H13ClN4S — CID 79301013
4-[[2-(chloromethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 79301013) has the molecular formula C13H13ClN4S and a molecular weight of 292.80 g/mol. Its IUPAC name is 4-[[2-(chloromethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[2-(chloromethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79301013 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 4-[[2-(chloromethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1cnc2c(c1)nc(CCl)n2Cc1csc(C)n1 |
| InChI | InChI=1S/C13H13ClN4S/c1-8-3-11-13(15-5-8)18(12(4-14)17-11)6-10-7-19-9(2)16-10/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | XOUWVZUNKSJXRN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|