C13H15ClFN3O2 — CID 103593935
2-[2-(1-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl carbamate (PubChem CID 103593935) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl carbamate.
| Compound Name | 2-[2-(1-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 103593935 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[2-(1-chloroethyl)-5-fluoro-6-methylbenzimidazol-1-yl]ethyl carbamate |
| SMILES | Cc1cc2c(cc1F)nc(C(C)Cl)n2CCOC(N)=O |
| InChI | InChI=1S/C13H15ClFN3O2/c1-7-5-11-10(6-9(7)15)17-12(8(2)14)18(11)3-4-20-13(16)19/h5-6,8H,3-4H2,1-2H3,(H2,16,19) |
| InChIKey | LEWNGLZUUBAXCS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|