C14H15ClFIN2O — CID 66101591
2-(1-chloroethyl)-6-fluoro-5-iodo-1-(oxolan-2-ylmethyl)benzimidazole (PubChem CID 66101591) has the molecular formula C14H15ClFIN2O and a molecular weight of 408.64 g/mol. Its IUPAC name is 2-(1-chloroethyl)-6-fluoro-5-iodo-1-(oxolan-2-ylmethyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-6-fluoro-5-iodo-1-(oxolan-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 66101591 |
| Molecular Formula | C14H15ClFIN2O |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2-(1-chloroethyl)-6-fluoro-5-iodo-1-(oxolan-2-ylmethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(I)c(F)cc2n1CC1CCCO1 |
| InChI | InChI=1S/C14H15ClFIN2O/c1-8(15)14-18-12-6-11(17)10(16)5-13(12)19(14)7-9-3-2-4-20-9/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | KBQJXQKOWCYSSK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|