C14H12ClFIN3S — CID 66093646
5-[[2-(1-chloroethyl)-6-fluoro-5-iodobenzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 66093646) has the molecular formula C14H12ClFIN3S and a molecular weight of 435.69 g/mol. Its IUPAC name is 5-[[2-(1-chloroethyl)-6-fluoro-5-iodobenzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[[2-(1-chloroethyl)-6-fluoro-5-iodobenzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 66093646 |
| Molecular Formula | C14H12ClFIN3S |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | 5-[[2-(1-chloroethyl)-6-fluoro-5-iodobenzimidazol-1-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(Cn2c(C(C)Cl)nc3cc(I)c(F)cc32)s1 |
| InChI | InChI=1S/C14H12ClFIN3S/c1-7(15)14-19-12-4-11(17)10(16)3-13(12)20(14)6-9-5-18-8(2)21-9/h3-5,7H,6H2,1-2H3 |
| InChIKey | UEAMCQDDJHJUIL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|