C15H18ClFN2S — CID 107297304
2-(1-chloroethyl)-5-fluoro-6-methyl-1-(thiolan-3-ylmethyl)benzimidazole (PubChem CID 107297304) has the molecular formula C15H18ClFN2S and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-fluoro-6-methyl-1-(thiolan-3-ylmethyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-(thiolan-3-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 107297304 |
| Molecular Formula | C15H18ClFN2S |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-(thiolan-3-ylmethyl)benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(C(C)Cl)n2CC1CCSC1 |
| InChI | InChI=1S/C15H18ClFN2S/c1-9-5-14-13(6-12(9)17)18-15(10(2)16)19(14)7-11-3-4-20-8-11/h5-6,10-11H,3-4,7-8H2,1-2H3 |
| InChIKey | HBEAXLLWXHMKIL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|