C16H19BrClFN2 — CID 107414410
6-bromo-2-(1-chloroethyl)-5-fluoro-1-[(3-methylcyclopentyl)methyl]benzimidazole (PubChem CID 107414410) has the molecular formula C16H19BrClFN2 and a molecular weight of 373.70 g/mol. Its IUPAC name is 6-bromo-2-(1-chloroethyl)-5-fluoro-1-[(3-methylcyclopentyl)methyl]benzimidazole.
| Compound Name | 6-bromo-2-(1-chloroethyl)-5-fluoro-1-[(3-methylcyclopentyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 107414410 |
| Molecular Formula | C16H19BrClFN2 |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 6-bromo-2-(1-chloroethyl)-5-fluoro-1-[(3-methylcyclopentyl)methyl]benzimidazole |
| SMILES | CC1CCC(Cn2c(C(C)Cl)nc3cc(F)c(Br)cc32)C1 |
| InChI | InChI=1S/C16H19BrClFN2/c1-9-3-4-11(5-9)8-21-15-6-12(17)13(19)7-14(15)20-16(21)10(2)18/h6-7,9-11H,3-5,8H2,1-2H3 |
| InChIKey | OFERPKKNDQTEHQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|